C29H28F3N7O3 — CID 118336507
5,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118336507) has the molecular formula C29H28F3N7O3 and a molecular weight of 579.58 g/mol. Its IUPAC name is 5,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 5,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118336507 |
| Molecular Formula | C29H28F3N7O3 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 5,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cccn2c1-c1nc2c(c(C(=O)N3CCN(C)CC3)n1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C29H28F3N7O3/c1-15-23(39-9-5-6-19(26(39)33-15)42-14-16-17(30)7-8-18(31)21(16)32)25-34-22(27(40)38-12-10-37(4)11-13-38)20-24(35-25)36-28(41)29(20,2)3/h5-9H,10-14H2,1-4H3,(H,34,35,36,41) |
| InChIKey | YBTICUMRMZLWTM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|