C28H24F5N7O3 — CID 118336541
4-(4-amino-3,3-difluoropyrrolidine-1-carbonyl)-5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118336541) has the molecular formula C28H24F5N7O3 and a molecular weight of 601.54 g/mol. Its IUPAC name is 4-(4-amino-3,3-difluoropyrrolidine-1-carbonyl)-5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-(4-amino-3,3-difluoropyrrolidine-1-carbonyl)-5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118336541 |
| Molecular Formula | C28H24F5N7O3 |
| Molecular Weight | 601.54 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 4-(4-amino-3,3-difluoropyrrolidine-1-carbonyl)-5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cccn2c1-c1nc2c(c(C(=O)N3CC(N)C(F)(F)C3)n1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C28H24F5N7O3/c1-12-21(40-8-4-5-16(24(40)35-12)43-10-13-14(29)6-7-15(30)19(13)31)23-36-20(18-22(37-23)38-26(42)27(18,2)3)25(41)39-9-17(34)28(32,33)11-39/h4-8,17H,9-11,34H2,1-3H3,(H,36,37,38,42) |
| InChIKey | UFOYUXCCAFLECU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|