C18H36O4S — CID 118336586
(2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)-5-methoxythiolane (PubChem CID 118336586) has the molecular formula C18H36O4S and a molecular weight of 348.55 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)-5-methoxythiolane.
| Compound Name | (2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)-5-methoxythiolane |
|---|---|
| PubChem CID | 118336586 |
| Molecular Formula | C18H36O4S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)-5-methoxythiolane |
| SMILES | CCCCOC[C@H]1SC(OC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C18H36O4S/c1-5-8-11-20-14-15-16(21-12-9-6-2)17(18(19-4)23-15)22-13-10-7-3/h15-18H,5-14H2,1-4H3/t15-,16+,17+,18?/m1/s1 |
| InChIKey | CUYPDXVWOIOQIF-KKSQLVLISA-N |
| XLogP | 4.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|