About 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one
3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 118336632) has the molecular formula C22H17NO4
and a molecular weight of 359.38 g/mol. Its IUPAC name is 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 118336632 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | COc1ccc2c(c1)C1(OC2=O)c2ccc(C)cc2Oc2cc(N)ccc21 |
| InChI | InChI=1S/C22H17NO4/c1-12-3-7-16-19(9-12)26-20-10-13(23)4-8-17(20)22(16)18-11-14(25-2)5-6-15(18)21(24)27-22/h3-11H,23H2,1-2H3 |
| InChIKey | SBGAFKCTZQJTDU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 118336632) is 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one is COc1ccc2c(c1)C1(OC2=O)c2ccc(C)cc2Oc2cc(N)ccc21.
What is the InChIKey of 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is SBGAFKCTZQJTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO4/c1-12-3-7-16-19(9-12)26-20-10-13(23)4-8-17(20)22(16)18-11-14(25-2)5-6-15(18)21(24)27-22/h3-11H,23H2,1-2H3.
What are the key properties of 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one?
3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 359.38 g/mol, XLogP of 4.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-amino-5-methoxy-6'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 118336632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).