C27H22F6N6O3 — CID 118336634
5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-N-(3,3,3-trifluoropropyl)-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide (PubChem CID 118336634) has the molecular formula C27H22F6N6O3 and a molecular weight of 592.50 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-N-(3,3,3-trifluoropropyl)-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-N-(3,3,3-trifluoropropyl)-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 118336634 |
| Molecular Formula | C27H22F6N6O3 |
| Molecular Weight | 592.50 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 5,5-dimethyl-2-[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-3-yl]-6-oxo-N-(3,3,3-trifluoropropyl)-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cccn2c1-c1nc2c(c(C(=O)NCCC(F)(F)F)n1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C27H22F6N6O3/c1-12-20(39-10-4-5-16(23(39)35-12)42-11-13-14(28)6-7-15(29)18(13)30)22-36-19(24(40)34-9-8-27(31,32)33)17-21(37-22)38-25(41)26(17,2)3/h4-7,10H,8-9,11H2,1-3H3,(H,34,40)(H,36,37,38,41) |
| InChIKey | MIDSRYYSMJJFQA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|