C17H14F3NO — CID 11833678
2-(2,6-dimethylphenyl)imino-3,3,3-trifluoro-1-phenylpropan-1-one (PubChem CID 11833678) has the molecular formula C17H14F3NO and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)imino-3,3,3-trifluoro-1-phenylpropan-1-one.
| Compound Name | 2-(2,6-dimethylphenyl)imino-3,3,3-trifluoro-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 11833678 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(2,6-dimethylphenyl)imino-3,3,3-trifluoro-1-phenylpropan-1-one |
| SMILES | Cc1cccc(C)c1/N=C(/C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H14F3NO/c1-11-7-6-8-12(2)14(11)21-16(17(18,19)20)15(22)13-9-4-3-5-10-13/h3-10H,1-2H3/b21-16- |
| InChIKey | FRWGTWKNIRCPAG-PGMHBOJBSA-N |
| XLogP | 4.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|