C26H18N4O3 — CID 118336833
2-[3-cyano-5,5-dimethyl-4-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]furan-2-ylidene]propanedinitrile (PubChem CID 118336833) has the molecular formula C26H18N4O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-[3-cyano-5,5-dimethyl-4-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-5,5-dimethyl-4-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 118336833 |
| Molecular Formula | C26H18N4O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-[3-cyano-5,5-dimethyl-4-[(E)-2-(5-oxo-4-oxa-12-azatricyclo[8.6.0.03,8]hexadeca-1(10),2,6,8-tetraen-15-yn-6-yl)ethenyl]furan-2-ylidene]propanedinitrile |
| SMILES | CC1(C)OC(=C(C#N)C#N)C(C#N)=C1/C=C/c1cc2cc3c(cc2oc1=O)C#CCCNC3 |
| InChI | InChI=1S/C26H18N4O3/c1-26(2)22(21(14-29)24(33-26)20(12-27)13-28)7-6-17-9-18-10-19-15-30-8-4-3-5-16(19)11-23(18)32-25(17)31/h6-7,9-11,30H,4,8,15H2,1-2H3/b7-6+ |
| InChIKey | LNDCBZGNTGCRMN-VOTSOKGWSA-N |
| XLogP | 3.58 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|