C18H30O2Si — CID 11833740
(1S,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenetricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 11833740) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (1S,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenetricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenetricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 11833740 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (1S,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenetricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | C=C1CC[C@@H]2C(=O)C[C@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@]132 |
| InChI | InChI=1S/C18H30O2Si/c1-12-7-8-15-16(19)10-13-9-14(11-18(12,13)15)20-21(5,6)17(2,3)4/h13-15H,1,7-11H2,2-6H3/t13-,14-,15-,18+/m1/s1 |
| InChIKey | GRTOMABVTINRLE-ADAWSYLGSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|