About 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine
4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 118338079) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
Molecular Properties
| Compound Name | 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| PubChem CID | 118338079 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | CC(C)c1ncnc2c1CCC2 |
| InChI | InChI=1S/C10H14N2/c1-7(2)10-8-4-3-5-9(8)11-6-12-10/h6-7H,3-5H2,1-2H3 |
| InChIKey | QZJACLBLYGAZNQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The IUPAC name of 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (CID 118338079) is 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
What is the SMILES notation for 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The canonical SMILES for 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is CC(C)c1ncnc2c1CCC2.
What is the InChIKey of 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The InChIKey is QZJACLBLYGAZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7(2)10-8-4-3-5-9(8)11-6-12-10/h6-7H,3-5H2,1-2H3.
What are the key properties of 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine has a molecular weight of 162.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is sourced from PubChem (CID 118338079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).