About 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole
5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole (PubChem CID 118338608) has the molecular formula C13H13BrF2N2
and a molecular weight of 315.16 g/mol. Its IUPAC name is 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole.
Molecular Properties
| Compound Name | 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole |
| PubChem CID | 118338608 |
| Molecular Formula | C13H13BrF2N2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole |
| SMILES | FC1(F)CCC(n2cnc3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C13H13BrF2N2/c14-9-1-2-12-11(7-9)17-8-18(12)10-3-5-13(15,16)6-4-10/h1-2,7-8,10H,3-6H2 |
| InChIKey | YPZFILFUAHHMFG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole?
The IUPAC name of 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole (CID 118338608) is 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole.
What is the SMILES notation for 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole?
The canonical SMILES for 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole is FC1(F)CCC(n2cnc3cc(Br)ccc32)CC1.
What is the InChIKey of 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole?
The InChIKey is YPZFILFUAHHMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrF2N2/c14-9-1-2-12-11(7-9)17-8-18(12)10-3-5-13(15,16)6-4-10/h1-2,7-8,10H,3-6H2.
What are the key properties of 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole?
5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole has a molecular weight of 315.16 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(4,4-difluorocyclohexyl)benzimidazole is sourced from PubChem (CID 118338608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).