About 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol
1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol (PubChem CID 118338713) has the molecular formula C24H31N5O
and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol |
| PubChem CID | 118338713 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol |
| SMILES | Nc1cc(N2CCC(O)CC2)cc(-c2ccc3c(c2)ncn3C2CCCCC2)c1N |
| InChI | InChI=1S/C24H31N5O/c25-21-14-18(28-10-8-19(30)9-11-28)13-20(24(21)26)16-6-7-23-22(12-16)27-15-29(23)17-4-2-1-3-5-17/h6-7,12-15,17,19,30H,1-5,8-11,25-26H2 |
| InChIKey | KIYVLJYXUOBVBK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol?
The IUPAC name of 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol (CID 118338713) is 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol.
What is the SMILES notation for 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol?
The canonical SMILES for 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol is Nc1cc(N2CCC(O)CC2)cc(-c2ccc3c(c2)ncn3C2CCCCC2)c1N.
What is the InChIKey of 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol?
The InChIKey is KIYVLJYXUOBVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N5O/c25-21-14-18(28-10-8-19(30)9-11-28)13-20(24(21)26)16-6-7-23-22(12-16)27-15-29(23)17-4-2-1-3-5-17/h6-7,12-15,17,19,30H,1-5,8-11,25-26H2.
What are the key properties of 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol?
1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol has a molecular weight of 405.55 g/mol, XLogP of 4.33, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,4-diamino-5-(1-cyclohexylbenzimidazol-5-yl)phenyl]piperidin-4-ol is sourced from PubChem (CID 118338713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).