About 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one
5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one (PubChem CID 118339181) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one |
| PubChem CID | 118339181 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one |
| SMILES | CCOCOc1cc2c(cc1OCOCC)C(=O)CC2 |
| InChI | InChI=1S/C15H20O5/c1-3-17-9-19-14-7-11-5-6-13(16)12(11)8-15(14)20-10-18-4-2/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | BNMQBECIVXLGOC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one?
The IUPAC name of 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one (CID 118339181) is 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one.
What is the SMILES notation for 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one?
The canonical SMILES for 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one is CCOCOc1cc2c(cc1OCOCC)C(=O)CC2.
What is the InChIKey of 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one?
The InChIKey is BNMQBECIVXLGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5/c1-3-17-9-19-14-7-11-5-6-13(16)12(11)8-15(14)20-10-18-4-2/h7-8H,3-6,9-10H2,1-2H3.
What are the key properties of 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one?
5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one has a molecular weight of 280.32 g/mol, XLogP of 2.56, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethoxymethoxy)-2,3-dihydroinden-1-one is sourced from PubChem (CID 118339181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).