About [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid
[5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid (PubChem CID 118339243) has the molecular formula C19H20N4O2
and a molecular weight of 336.40 g/mol. Its IUPAC name is [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid |
| PubChem CID | 118339243 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid |
| SMILES | Cc1ccc(-c2ccn(-c3ccc(C)c(CNC(=O)O)c3)n2)c(C)n1 |
| InChI | InChI=1S/C19H20N4O2/c1-12-4-6-16(10-15(12)11-20-19(24)25)23-9-8-18(22-23)17-7-5-13(2)21-14(17)3/h4-10,20H,11H2,1-3H3,(H,24,25) |
| InChIKey | MDCLUTRBJWNNRZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid?
The IUPAC name of [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid (CID 118339243) is [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid.
What is the SMILES notation for [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid?
The canonical SMILES for [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid is Cc1ccc(-c2ccn(-c3ccc(C)c(CNC(=O)O)c3)n2)c(C)n1.
What is the InChIKey of [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid?
The InChIKey is MDCLUTRBJWNNRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c1-12-4-6-16(10-15(12)11-20-19(24)25)23-9-8-18(22-23)17-7-5-13(2)21-14(17)3/h4-10,20H,11H2,1-3H3,(H,24,25).
What are the key properties of [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid?
[5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid has a molecular weight of 336.40 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-(2,6-dimethyl-3-pyridinyl)pyrazol-1-yl]-2-methylphenyl]methylcarbamic acid is sourced from PubChem (CID 118339243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).