C25H25N7O2S — CID 118339391
(5E)-5-[[6-[benzyl(methyl)amino]-2-(4-pyridin-3-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339391) has the molecular formula C25H25N7O2S and a molecular weight of 487.59 g/mol. Its IUPAC name is (5E)-5-[[6-[benzyl(methyl)amino]-2-(4-pyridin-3-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[6-[benzyl(methyl)amino]-2-(4-pyridin-3-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339391 |
| Molecular Formula | C25H25N7O2S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (5E)-5-[[6-[benzyl(methyl)amino]-2-(4-pyridin-3-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(Cc1ccccc1)c1cc(/C=C2/SC(=O)NC2=O)nc(N2CCN(c3cccnc3)CC2)n1 |
| InChI | InChI=1S/C25H25N7O2S/c1-30(17-18-6-3-2-4-7-18)22-15-19(14-21-23(33)29-25(34)35-21)27-24(28-22)32-12-10-31(11-13-32)20-8-5-9-26-16-20/h2-9,14-16H,10-13,17H2,1H3,(H,29,33,34)/b21-14+ |
| InChIKey | LSPJFDFFYCVZLD-KGENOOAVSA-N |
| XLogP | 3.16 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|