C26H24N6O5S — CID 118339394
2-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 118339394) has the molecular formula C26H24N6O5S and a molecular weight of 532.58 g/mol. Its IUPAC name is 2-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 2-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 118339394 |
| Molecular Formula | C26H24N6O5S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 2-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C1NC(=O)/C(=C\c2cc(OCc3ccco3)nc(N3CC4CN(C(=O)Nc5ccccc5)CC4C3)n2)S1 |
| InChI | InChI=1S/C26H24N6O5S/c33-23-21(38-26(35)30-23)9-19-10-22(37-15-20-7-4-8-36-20)29-24(27-19)31-11-16-13-32(14-17(16)12-31)25(34)28-18-5-2-1-3-6-18/h1-10,16-17H,11-15H2,(H,28,34)(H,30,33,35)/b21-9+ |
| InChIKey | WXKGTZUEMPEMHM-ZVBGSRNCSA-N |
| XLogP | 3.57 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|