C20H24N8O3S — CID 118339453
(5Z)-5-[[6-[2-(dimethylamino)ethoxy]-2-(4-pyrimidin-5-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339453) has the molecular formula C20H24N8O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is (5Z)-5-[[6-[2-(dimethylamino)ethoxy]-2-(4-pyrimidin-5-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[6-[2-(dimethylamino)ethoxy]-2-(4-pyrimidin-5-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339453 |
| Molecular Formula | C20H24N8O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (5Z)-5-[[6-[2-(dimethylamino)ethoxy]-2-(4-pyrimidin-5-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)CCOc1cc(/C=C2\SC(=O)NC2=O)nc(N2CCN(c3cncnc3)CC2)n1 |
| InChI | InChI=1S/C20H24N8O3S/c1-26(2)7-8-31-17-10-14(9-16-18(29)25-20(30)32-16)23-19(24-17)28-5-3-27(4-6-28)15-11-21-13-22-12-15/h9-13H,3-8H2,1-2H3,(H,25,29,30)/b16-9- |
| InChIKey | JFAKALQFNWPANX-SXGWCWSVSA-N |
| XLogP | 0.86 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|