C15H26O5Si — CID 11834004
ethyl 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]acetate (PubChem CID 11834004) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is ethyl 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]acetate |
|---|---|
| PubChem CID | 11834004 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ethyl 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[Si](C)(C)O[C@H]2C=C[C@@H](OCC)O[C@H]12 |
| InChI | InChI=1S/C15H26O5Si/c1-5-17-13(16)9-11-10-21(3,4)20-12-7-8-14(18-6-2)19-15(11)12/h7-8,11-12,14-15H,5-6,9-10H2,1-4H3/t11-,12-,14-,15+/m0/s1 |
| InChIKey | FWDXLXCPRZCPDP-NZBPQXDJSA-N |
| XLogP | 2.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|