C26H21FN4O6S2 — CID 118340262
[2,4-bis(benzylsulfonyl)-6-fluoro-9H-pyrimido[4,5-b]indol-8-yl]-methylcarbamic acid (PubChem CID 118340262) has the molecular formula C26H21FN4O6S2 and a molecular weight of 568.61 g/mol. Its IUPAC name is [2,4-bis(benzylsulfonyl)-6-fluoro-9H-pyrimido[4,5-b]indol-8-yl]-methylcarbamic acid.
| Compound Name | [2,4-bis(benzylsulfonyl)-6-fluoro-9H-pyrimido[4,5-b]indol-8-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 118340262 |
| Molecular Formula | C26H21FN4O6S2 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | [2,4-bis(benzylsulfonyl)-6-fluoro-9H-pyrimido[4,5-b]indol-8-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cc(F)cc2c1[nH]c1nc(S(=O)(=O)Cc3ccccc3)nc(S(=O)(=O)Cc3ccccc3)c12 |
| InChI | InChI=1S/C26H21FN4O6S2/c1-31(26(32)33)20-13-18(27)12-19-21-23(28-22(19)20)29-25(39(36,37)15-17-10-6-3-7-11-17)30-24(21)38(34,35)14-16-8-4-2-5-9-16/h2-13H,14-15H2,1H3,(H,32,33)(H,28,29,30) |
| InChIKey | UEYNOSWVMAMBDP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |