C29H23N7O3S — CID 118340746
N-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]-2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-amine (PubChem CID 118340746) has the molecular formula C29H23N7O3S and a molecular weight of 549.62 g/mol. Its IUPAC name is N-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]-2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-amine.
| Compound Name | N-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]-2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 118340746 |
| Molecular Formula | C29H23N7O3S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | N-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]-2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-amine |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1nc(C)nc(Nc3sc(-c4ncco4)nc3-c3ccccc3)c12 |
| InChI | InChI=1S/C29H23N7O3S/c1-14-22(15(2)39-36-14)19-12-20-18(13-21(19)37-4)23-25(33-20)31-16(3)32-26(23)35-28-24(17-8-6-5-7-9-17)34-29(40-28)27-30-10-11-38-27/h5-13H,1-4H3,(H2,31,32,33,35) |
| InChIKey | KCIUTITXWANDDT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |