C11H10O5S3 — CID 11834120
dimethyl 2-(5-oxothiolan-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11834120) has the molecular formula C11H10O5S3 and a molecular weight of 318.40 g/mol. Its IUPAC name is dimethyl 2-(5-oxothiolan-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5-oxothiolan-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11834120 |
| Molecular Formula | C11H10O5S3 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | dimethyl 2-(5-oxothiolan-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2CCC(=O)S2)S1 |
| InChI | InChI=1S/C11H10O5S3/c1-15-9(13)7-8(10(14)16-2)19-11(18-7)5-3-4-6(12)17-5/h3-4H2,1-2H3 |
| InChIKey | HRWDJOYPRWDUJW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|