About 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol
2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol (PubChem CID 118341280) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol.
Molecular Properties
| Compound Name | 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol |
| PubChem CID | 118341280 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol |
| SMILES | COc1ccc(/C=C/c2ccc3c(C)cc(C)c(O)c3n2)cn1 |
| InChI | InChI=1S/C19H18N2O2/c1-12-10-13(2)19(22)18-16(12)8-7-15(21-18)6-4-14-5-9-17(23-3)20-11-14/h4-11,22H,1-3H3/b6-4+ |
| InChIKey | NYOIPKSDZCHGON-GQCTYLIASA-N |
| XLogP | 4.13 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol?
The IUPAC name of 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol (CID 118341280) is 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol.
What is the SMILES notation for 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol?
The canonical SMILES for 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol is COc1ccc(/C=C/c2ccc3c(C)cc(C)c(O)c3n2)cn1.
What is the InChIKey of 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol?
The InChIKey is NYOIPKSDZCHGON-GQCTYLIASA-N. The full InChI is InChI=1S/C19H18N2O2/c1-12-10-13(2)19(22)18-16(12)8-7-15(21-18)6-4-14-5-9-17(23-3)20-11-14/h4-11,22H,1-3H3/b6-4+.
What are the key properties of 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol?
2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol has a molecular weight of 306.37 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(6-methoxy-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol is sourced from PubChem (CID 118341280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).