C21H14F5N5O2 — CID 118341345
6-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 118341345) has the molecular formula C21H14F5N5O2 and a molecular weight of 463.37 g/mol. Its IUPAC name is 6-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 6-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118341345 |
| Molecular Formula | C21H14F5N5O2 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 6-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(Nc2cc(-c3c(F)cccc3F)nc3c2C(=O)NC3)nc1 |
| InChI | InChI=1S/C21H14F5N5O2/c22-11-2-1-3-12(23)17(11)13-6-14(18-15(30-13)8-28-20(18)33)31-16-5-4-10(7-27-16)19(32)29-9-21(24,25)26/h1-7H,8-9H2,(H,28,33)(H,29,32)(H,27,30,31) |
| InChIKey | BFDCXBNYCJUFNQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |