C26H24F2N4O3 — CID 118341347
2-(2,6-difluorophenyl)-4-[4-[(3R,5R)-3,5-dimethylmorpholine-4-carbonyl]anilino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 118341347) has the molecular formula C26H24F2N4O3 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[4-[(3R,5R)-3,5-dimethylmorpholine-4-carbonyl]anilino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-4-[4-[(3R,5R)-3,5-dimethylmorpholine-4-carbonyl]anilino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 118341347 |
| Molecular Formula | C26H24F2N4O3 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[4-[(3R,5R)-3,5-dimethylmorpholine-4-carbonyl]anilino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | C[C@@H]1COC[C@@H](C)N1C(=O)c1ccc(Nc2cc(-c3c(F)cccc3F)nc3c2C(=O)NC3)cc1 |
| InChI | InChI=1S/C26H24F2N4O3/c1-14-12-35-13-15(2)32(14)26(34)16-6-8-17(9-7-16)30-21-10-20(23-18(27)4-3-5-19(23)28)31-22-11-29-25(33)24(21)22/h3-10,14-15H,11-13H2,1-2H3,(H,29,33)(H,30,31)/t14-,15-/m1/s1 |
| InChIKey | GRHAOYWBLSICFB-HUUCEWRRSA-N |
| XLogP | 4.26 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |