C25H18ClF2N3O2 — CID 118341544
(6S)-6-(4-chlorophenyl)-3-[2,6-difluoro-4-(2-pyridin-3-ylethynyl)phenyl]-1,6-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 118341544) has the molecular formula C25H18ClF2N3O2 and a molecular weight of 465.89 g/mol. Its IUPAC name is (6S)-6-(4-chlorophenyl)-3-[2,6-difluoro-4-(2-pyridin-3-ylethynyl)phenyl]-1,6-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-6-(4-chlorophenyl)-3-[2,6-difluoro-4-(2-pyridin-3-ylethynyl)phenyl]-1,6-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 118341544 |
| Molecular Formula | C25H18ClF2N3O2 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (6S)-6-(4-chlorophenyl)-3-[2,6-difluoro-4-(2-pyridin-3-ylethynyl)phenyl]-1,6-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)N(c2c(F)cc(C#Cc3cccnc3)cc2F)C(=O)C[C@@]1(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClF2N3O2/c1-25(18-7-9-19(26)10-8-18)14-22(32)31(24(33)30(25)2)23-20(27)12-17(13-21(23)28)6-5-16-4-3-11-29-15-16/h3-4,7-13,15H,14H2,1-2H3/t25-/m0/s1 |
| InChIKey | GLDLXGLIKKSXGV-VWLOTQADSA-N |
| XLogP | 5.12 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|