C32H35N5O2S — CID 118341803
3-methyl-N-[3-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]phenyl]butanamide (PubChem CID 118341803) has the molecular formula C32H35N5O2S and a molecular weight of 553.73 g/mol. Its IUPAC name is 3-methyl-N-[3-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]phenyl]butanamide.
| Compound Name | 3-methyl-N-[3-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 118341803 |
| Molecular Formula | C32H35N5O2S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 3-methyl-N-[3-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1cccc(-c2sc3c(c2-c2ccnc(Nc4ccc(N5CCOCC5)cc4)n2)CCC3)c1 |
| InChI | InChI=1S/C32H35N5O2S/c1-21(2)19-29(38)34-24-6-3-5-22(20-24)31-30(26-7-4-8-28(26)40-31)27-13-14-33-32(36-27)35-23-9-11-25(12-10-23)37-15-17-39-18-16-37/h3,5-6,9-14,20-21H,4,7-8,15-19H2,1-2H3,(H,34,38)(H,33,35,36) |
| InChIKey | UWKZCKYSBIETOI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|