C14H21NO2 — CID 118342901
(7aR)-3,3-dimethyl-6,6-bis(prop-2-enyl)-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118342901) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (7aR)-3,3-dimethyl-6,6-bis(prop-2-enyl)-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7aR)-3,3-dimethyl-6,6-bis(prop-2-enyl)-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118342901 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (7aR)-3,3-dimethyl-6,6-bis(prop-2-enyl)-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CCC1(CC=C)C[C@@H]2COC(C)(C)N2C1=O |
| InChI | InChI=1S/C14H21NO2/c1-5-7-14(8-6-2)9-11-10-17-13(3,4)15(11)12(14)16/h5-6,11H,1-2,7-10H2,3-4H3/t11-/m1/s1 |
| InChIKey | CXAYYFJMNDFTQY-LLVKDONJSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|