C10H17NO2 — CID 118342904
1,1,3,3-tetramethyl-7,7a-dihydro-6H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118342904) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-7,7a-dihydro-6H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | 1,1,3,3-tetramethyl-7,7a-dihydro-6H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118342904 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1,1,3,3-tetramethyl-7,7a-dihydro-6H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC(C)(C)N2C(=O)CCC21 |
| InChI | InChI=1S/C10H17NO2/c1-9(2)7-5-6-8(12)11(7)10(3,4)13-9/h7H,5-6H2,1-4H3 |
| InChIKey | RWOQFKXYFHJEOQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |