C18H28O5 — CID 11834298
(1R,3R,6S,9R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-10-oxatricyclo[7.2.1.01,6]dodec-4-en-11-one (PubChem CID 11834298) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R,3R,6S,9R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-10-oxatricyclo[7.2.1.01,6]dodec-4-en-11-one.
| Compound Name | (1R,3R,6S,9R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-10-oxatricyclo[7.2.1.01,6]dodec-4-en-11-one |
|---|---|
| PubChem CID | 11834298 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (1R,3R,6S,9R)-3-(2-methoxyethoxymethoxymethyl)-7,7-dimethyl-10-oxatricyclo[7.2.1.01,6]dodec-4-en-11-one |
| SMILES | COCCOCOC[C@H]1C=C[C@H]2C(C)(C)C[C@@H]3C[C@@]2(C1)C(=O)O3 |
| InChI | InChI=1S/C18H28O5/c1-17(2)9-14-10-18(16(19)23-14)8-13(4-5-15(17)18)11-22-12-21-7-6-20-3/h4-5,13-15H,6-12H2,1-3H3/t13-,14+,15-,18+/m0/s1 |
| InChIKey | CQZPOHQFZQWLOD-JTOWHCCKSA-N |
| XLogP | 2.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|