About [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol
[(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol (PubChem CID 118343076) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol |
| PubChem CID | 118343076 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol |
| SMILES | C=CCC1(CC=C)CN[C@@H](CO)C1 |
| InChI | InChI=1S/C11H19NO/c1-3-5-11(6-4-2)7-10(8-13)12-9-11/h3-4,10,12-13H,1-2,5-9H2/t10-/m1/s1 |
| InChIKey | LMPQNTLHQARUFV-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol (CID 118343076) is [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol is C=CCC1(CC=C)CN[C@@H](CO)C1.
What is the InChIKey of [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol?
The InChIKey is LMPQNTLHQARUFV-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-5-11(6-4-2)7-10(8-13)12-9-11/h3-4,10,12-13H,1-2,5-9H2/t10-/m1/s1.
What are the key properties of [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol?
[(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol has a molecular weight of 181.28 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 118343076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).