C23H28O3S — CID 118343110
4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzenesulfonic acid (PubChem CID 118343110) has the molecular formula C23H28O3S and a molecular weight of 384.54 g/mol. Its IUPAC name is 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzenesulfonic acid.
| Compound Name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118343110 |
| Molecular Formula | C23H28O3S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzenesulfonic acid |
| SMILES | C=C(c1ccc(S(=O)(=O)O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H28O3S/c1-15-13-20-21(23(5,6)12-11-22(20,3)4)14-19(15)16(2)17-7-9-18(10-8-17)27(24,25)26/h7-10,13-14H,2,11-12H2,1,3-6H3,(H,24,25,26) |
| InChIKey | OMEILGWMMVWOFI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|