C18H32O3Si — CID 11834317
methyl (2Z,4E)-5,9-dimethyl-2-(1-trimethylsilyloxyethylidene)deca-4,8-dienoate (PubChem CID 11834317) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is methyl (2Z,4E)-5,9-dimethyl-2-(1-trimethylsilyloxyethylidene)deca-4,8-dienoate.
| Compound Name | methyl (2Z,4E)-5,9-dimethyl-2-(1-trimethylsilyloxyethylidene)deca-4,8-dienoate |
|---|---|
| PubChem CID | 11834317 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | methyl (2Z,4E)-5,9-dimethyl-2-(1-trimethylsilyloxyethylidene)deca-4,8-dienoate |
| SMILES | COC(=O)/C(C/C=C(\C)CCC=C(C)C)=C(/C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-14(2)10-9-11-15(3)12-13-17(18(19)20-5)16(4)21-22(6,7)8/h10,12H,9,11,13H2,1-8H3/b15-12+,17-16- |
| InChIKey | QGTTZSLUUQVYAR-BUZNKOHXSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|