About 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+)
1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) (PubChem CID 118343257) has the molecular formula C23H35ClCuN2
and a molecular weight of 438.55 g/mol. Its IUPAC name is 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+).
Molecular Properties
| Compound Name | 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) |
| PubChem CID | 118343257 |
| Molecular Formula | C23H35ClCuN2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) |
| SMILES | C1CN(C23CC4CC(CC(C4)C2)C3)[C-](C23CC4CC(CC(C4)C2)C3)N1.Cl[Cu+] |
| InChI | InChI=1S/C23H35N2.ClH.Cu/c1-2-25(23-12-18-6-19(13-23)8-20(7-18)14-23)21(24-1)22-9-15-3-16(10-22)5-17(4-15)11-22;;/h15-20,24H,1-14H2;1H;/q-1;;+2/p-1 |
| InChIKey | BSORLOYGHQKKRG-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+)?
The IUPAC name of 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) (CID 118343257) is 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+).
What is the SMILES notation for 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+)?
The canonical SMILES for 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) is C1CN(C23CC4CC(CC(C4)C2)C3)[C-](C23CC4CC(CC(C4)C2)C3)N1.Cl[Cu+].
What is the InChIKey of 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+)?
The InChIKey is BSORLOYGHQKKRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H35N2.ClH.Cu/c1-2-25(23-12-18-6-19(13-23)8-20(7-18)14-23)21(24-1)22-9-15-3-16(10-22)5-17(4-15)11-22;;/h15-20,24H,1-14H2;1H;/q-1;;+2/p-1.
What are the key properties of 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+)?
1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) has a molecular weight of 438.55 g/mol, XLogP of 5.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(1-adamantyl)imidazolidin-2-ide;chlorocopper(1+) is sourced from PubChem (CID 118343257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).