C26H30N8O — CID 118343260
1-[7-[2-methoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]-3-methyl-8H-2,7-naphthyridin-1-yl]-2,2,3-trimethylazetidine-3-carbonitrile (PubChem CID 118343260) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[7-[2-methoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]-3-methyl-8H-2,7-naphthyridin-1-yl]-2,2,3-trimethylazetidine-3-carbonitrile.
| Compound Name | 1-[7-[2-methoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]-3-methyl-8H-2,7-naphthyridin-1-yl]-2,2,3-trimethylazetidine-3-carbonitrile |
|---|---|
| PubChem CID | 118343260 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 1-[7-[2-methoxy-4-(4-methyl-1,2,4-triazol-3-yl)anilino]-3-methyl-8H-2,7-naphthyridin-1-yl]-2,2,3-trimethylazetidine-3-carbonitrile |
| SMILES | COc1cc(-c2nncn2C)ccc1NN1C=Cc2cc(C)nc(N3CC(C)(C#N)C3(C)C)c2C1 |
| InChI | InChI=1S/C26H30N8O/c1-17-11-18-9-10-33(13-20(18)24(29-17)34-15-26(4,14-27)25(34,2)3)31-21-8-7-19(12-22(21)35-6)23-30-28-16-32(23)5/h7-12,16,31H,13,15H2,1-6H3 |
| InChIKey | XRFBWPZHOZFQCD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |