C26H17F7N2O3 — CID 118343275
3-(3,4-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 118343275) has the molecular formula C26H17F7N2O3 and a molecular weight of 538.42 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 118343275 |
| Molecular Formula | C26H17F7N2O3 |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccc(CC(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)N2C(=O)c3ccccc3C2=O)cc1C |
| InChI | InChI=1S/C26H17F7N2O3/c1-11-7-8-13(9-12(11)2)10-16(35-24(37)14-5-3-4-6-15(14)25(35)38)23(36)34-22-20(29)18(27)17(26(31,32)33)19(28)21(22)30/h3-9,16H,10H2,1-2H3,(H,34,36) |
| InChIKey | PSBQMEBEAGEQLQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|