C26H11F13N2O3 — CID 118343344
2-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxoisoindol-2-yl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 118343344) has the molecular formula C26H11F13N2O3 and a molecular weight of 646.36 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxoisoindol-2-yl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxoisoindol-2-yl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 118343344 |
| Molecular Formula | C26H11F13N2O3 |
| Molecular Weight | 646.36 g/mol |
| Exact Mass | 646.06 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxoisoindol-2-yl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)N1C(=O)c2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2C1=O |
| InChI | InChI=1S/C26H11F13N2O3/c1-8(21(42)40-20-18(29)16(27)15(26(37,38)39)17(28)19(20)30)41-22(43)13-4-2-3-12(14(13)23(41)44)9-5-10(24(31,32)33)7-11(6-9)25(34,35)36/h2-8H,1H3,(H,40,42) |
| InChIKey | XUFZQIPYVDNMIG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.36 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|