About (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol
(1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol (PubChem CID 11834352) has the molecular formula C18H35N3O2
and a molecular weight of 325.50 g/mol. Its IUPAC name is (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol |
| PubChem CID | 11834352 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol |
| SMILES | CCCCCCCCCCCCn1nc([C@H](C)O)nc1[C@H](C)O |
| InChI | InChI=1S/C18H35N3O2/c1-4-5-6-7-8-9-10-11-12-13-14-21-18(16(3)23)19-17(20-21)15(2)22/h15-16,22-23H,4-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | YDYHBFXDRJMNMQ-HOTGVXAUSA-N |
| XLogP | 4.31 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol?
The IUPAC name of (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol (CID 11834352) is (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol.
What is the SMILES notation for (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol?
The canonical SMILES for (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol is CCCCCCCCCCCCn1nc([C@H](C)O)nc1[C@H](C)O.
What is the InChIKey of (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol?
The InChIKey is YDYHBFXDRJMNMQ-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H35N3O2/c1-4-5-6-7-8-9-10-11-12-13-14-21-18(16(3)23)19-17(20-21)15(2)22/h15-16,22-23H,4-14H2,1-3H3/t15-,16-/m0/s1.
What are the key properties of (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol?
(1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol has a molecular weight of 325.50 g/mol, XLogP of 4.31, 13 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[1-dodecyl-5-[(1S)-1-hydroxyethyl]-1,2,4-triazol-3-yl]ethanol is sourced from PubChem (CID 11834352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).