C19H14N4O3S — CID 118343546
3-methyl-7,12-dihydroquinoxalino[2,3-b]phenazine-6-sulfonic acid (PubChem CID 118343546) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-methyl-7,12-dihydroquinoxalino[2,3-b]phenazine-6-sulfonic acid.
| Compound Name | 3-methyl-7,12-dihydroquinoxalino[2,3-b]phenazine-6-sulfonic acid |
|---|---|
| PubChem CID | 118343546 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 3-methyl-7,12-dihydroquinoxalino[2,3-b]phenazine-6-sulfonic acid |
| SMILES | Cc1ccc2nc3cc4c(c(S(=O)(=O)O)c3nc2c1)Nc1ccccc1N4 |
| InChI | InChI=1S/C19H14N4O3S/c1-10-6-7-13-14(8-10)23-18-16(21-13)9-15-17(19(18)27(24,25)26)22-12-5-3-2-4-11(12)20-15/h2-9,20,22H,1H3,(H,24,25,26) |
| InChIKey | DQPOFXKDDWYUPE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|