C19H8ClF6N3O3 — CID 118343575
N-[5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)pyrazin-2-yl]-2,6-difluorobenzamide (PubChem CID 118343575) has the molecular formula C19H8ClF6N3O3 and a molecular weight of 475.73 g/mol. Its IUPAC name is N-[5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)pyrazin-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)pyrazin-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 118343575 |
| Molecular Formula | C19H8ClF6N3O3 |
| Molecular Weight | 475.73 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | N-[5-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)pyrazin-2-yl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1cnc(-c2cc3c(cc2Cl)OC(F)(F)C(F)(F)O3)cn1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H8ClF6N3O3/c20-9-5-14-13(31-18(23,24)19(25,26)32-14)4-8(9)12-6-28-15(7-27-12)29-17(30)16-10(21)2-1-3-11(16)22/h1-7H,(H,28,29,30) |
| InChIKey | NGRPJNQXPYUSLC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|