About ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate
ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate (PubChem CID 118344011) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate |
| PubChem CID | 118344011 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate |
| SMILES | CCOC(=O)Cc1nc(C(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C10H17N3O2/c1-5-15-8(14)6-7-11-9(13-12-7)10(2,3)4/h5-6H2,1-4H3,(H,11,12,13) |
| InChIKey | VPNQVHSFGWBSHI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate?
The IUPAC name of ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate (CID 118344011) is ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate.
What is the SMILES notation for ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate?
The canonical SMILES for ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate is CCOC(=O)Cc1nc(C(C)(C)C)n[nH]1.
What is the InChIKey of ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate?
The InChIKey is VPNQVHSFGWBSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-5-15-8(14)6-7-11-9(13-12-7)10(2,3)4/h5-6H2,1-4H3,(H,11,12,13).
What are the key properties of ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate?
ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate has a molecular weight of 211.26 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)acetate is sourced from PubChem (CID 118344011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).