About N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride
N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (PubChem CID 11834418) has the molecular formula C10H12Cl2N2
and a molecular weight of 231.13 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| PubChem CID | 11834418 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| SMILES | Cl.Clc1cccc(NC2=NCCC2)c1 |
| InChI | InChI=1S/C10H11ClN2.ClH/c11-8-3-1-4-9(7-8)13-10-5-2-6-12-10;/h1,3-4,7H,2,5-6H2,(H,12,13);1H |
| InChIKey | XGVYGPHDNJOTLN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The IUPAC name of N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (CID 11834418) is N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
What is the SMILES notation for N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The canonical SMILES for N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is Cl.Clc1cccc(NC2=NCCC2)c1.
What is the InChIKey of N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The InChIKey is XGVYGPHDNJOTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2.ClH/c11-8-3-1-4-9(7-8)13-10-5-2-6-12-10;/h1,3-4,7H,2,5-6H2,(H,12,13);1H.
What are the key properties of N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride has a molecular weight of 231.13 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is sourced from PubChem (CID 11834418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).