About 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride
4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride (PubChem CID 11834426) has the molecular formula C15H16ClN3O2S
and a molecular weight of 337.83 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride |
| PubChem CID | 11834426 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride |
| SMILES | COCCn1c(-c2ccco2)cs/c1=N\c1cccnc1.Cl |
| InChI | InChI=1S/C15H15N3O2S.ClH/c1-19-9-7-18-13(14-5-3-8-20-14)11-21-15(18)17-12-4-2-6-16-10-12;/h2-6,8,10-11H,7,9H2,1H3;1H/b17-15-; |
| InChIKey | XXROOFMYDCASNL-NYDCQJDFSA-N |
| XLogP | 3.51 |
| TPSA | 52.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride?
The IUPAC name of 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride (CID 11834426) is 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride.
What is the SMILES notation for 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride?
The canonical SMILES for 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride is COCCn1c(-c2ccco2)cs/c1=N\c1cccnc1.Cl.
What is the InChIKey of 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride?
The InChIKey is XXROOFMYDCASNL-NYDCQJDFSA-N. The full InChI is InChI=1S/C15H15N3O2S.ClH/c1-19-9-7-18-13(14-5-3-8-20-14)11-21-15(18)17-12-4-2-6-16-10-12;/h2-6,8,10-11H,7,9H2,1H3;1H/b17-15-;.
What are the key properties of 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride?
4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride has a molecular weight of 337.83 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-3-(2-methoxyethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine;hydrochloride is sourced from PubChem (CID 11834426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).