C24H34N4O13 — CID 118344662
methyl (3aR,6R,7aR)-3-acetyl-6-(5-azidopentoxy)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 118344662) has the molecular formula C24H34N4O13 and a molecular weight of 586.55 g/mol. Its IUPAC name is methyl (3aR,6R,7aR)-3-acetyl-6-(5-azidopentoxy)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3aR,6R,7aR)-3-acetyl-6-(5-azidopentoxy)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 118344662 |
| Molecular Formula | C24H34N4O13 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | methyl (3aR,6R,7aR)-3-acetyl-6-(5-azidopentoxy)-2-oxo-4-[(1S,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@@]1(OCCCCCN=[N+]=[N-])C[C@H]2OC(=O)N(C(C)=O)[C@H]2C([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C24H34N4O13/c1-13(29)28-19-17(40-23(28)34)11-24(22(33)35-5,37-10-8-6-7-9-26-27-25)41-21(19)20(39-16(4)32)18(38-15(3)31)12-36-14(2)30/h17-21H,6-12H2,1-5H3/t17-,18-,19-,20-,21?,24-/m1/s1 |
| InChIKey | DMBCELYCIWGKQE-WFQZDWOLSA-N |
| XLogP | 1.30 |
| TPSA | 219.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|