C12H12ClF9S — CID 118344803
2-chlorohexyl-tetrafluoro-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane (PubChem CID 118344803) has the molecular formula C12H12ClF9S and a molecular weight of 394.73 g/mol. Its IUPAC name is 2-chlorohexyl-tetrafluoro-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane.
| Compound Name | 2-chlorohexyl-tetrafluoro-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane |
|---|---|
| PubChem CID | 118344803 |
| Molecular Formula | C12H12ClF9S |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-chlorohexyl-tetrafluoro-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane |
| SMILES | CCCCC(Cl)CS(F)(F)(F)(F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12ClF9S/c1-2-3-4-6(13)5-23(19,20,21,22)12-10(17)8(15)7(14)9(16)11(12)18/h6H,2-5H2,1H3 |
| InChIKey | SGWGTLNKJSZRCE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|