C68H68N6 — CID 118345820
2-[4-(4-methyl-2,5-dioctylphenyl)-6-[4-[6-[3-(4-methylphenyl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyrimidin-2-yl]-1,10-phenanthroline (PubChem CID 118345820) has the molecular formula C68H68N6 and a molecular weight of 969.33 g/mol. Its IUPAC name is 2-[4-(4-methyl-2,5-dioctylphenyl)-6-[4-[6-[3-(4-methylphenyl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyrimidin-2-yl]-1,10-phenanthroline.
| Compound Name | 2-[4-(4-methyl-2,5-dioctylphenyl)-6-[4-[6-[3-(4-methylphenyl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyrimidin-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 118345820 |
| Molecular Formula | C68H68N6 |
| Molecular Weight | 969.33 g/mol |
| Exact Mass | 968.55 |
| IUPAC Name | 2-[4-(4-methyl-2,5-dioctylphenyl)-6-[4-[6-[3-(4-methylphenyl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyrimidin-2-yl]-1,10-phenanthroline |
| SMILES | CCCCCCCCc1cc(-c2cc(-c3ccc(-c4cc(-c5cccc(-c6ccc(C)cc6)c5)nc(-c5ccccc5)n4)cc3)nc(-c3ccc4ccc5cccnc5c4n3)n2)c(CCCCCCCC)cc1C |
| InChI | InChI=1S/C68H68N6/c1-5-7-9-11-13-16-24-55-44-59(57(42-48(55)4)25-17-14-12-10-8-6-2)64-46-62(73-68(74-64)60-40-39-53-38-37-52-28-21-41-69-65(52)66(53)70-60)51-35-33-50(34-36-51)61-45-63(72-67(71-61)54-22-18-15-19-23-54)58-27-20-26-56(43-58)49-31-29-47(3)30-32-49/h15,18-23,26-46H,5-14,16-17,24-25H2,1-4H3 |
| InChIKey | GASFYIGOUQRBHW-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.33 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|