About (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine
(E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine (PubChem CID 118346045) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine.
Molecular Properties
| Compound Name | (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine |
| PubChem CID | 118346045 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine |
| SMILES | [H]/N=C(C(=C/C(C)C)/C(C)C)\C(C)C |
| InChI | InChI=1S/C12H23N/c1-8(2)7-11(9(3)4)12(13)10(5)6/h7-10,13H,1-6H3/b11-7+,13-12+ |
| InChIKey | OBTOUQCOFVQUGU-FREZGGHOSA-N |
| XLogP | 3.90 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine?
The IUPAC name of (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine (CID 118346045) is (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine.
What is the SMILES notation for (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine?
The canonical SMILES for (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine is [H]/N=C(C(=C/C(C)C)/C(C)C)\C(C)C.
What is the InChIKey of (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine?
The InChIKey is OBTOUQCOFVQUGU-FREZGGHOSA-N. The full InChI is InChI=1S/C12H23N/c1-8(2)7-11(9(3)4)12(13)10(5)6/h7-10,13H,1-6H3/b11-7+,13-12+.
What are the key properties of (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine?
(E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine has a molecular weight of 181.32 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,6-dimethyl-4-propan-2-ylhept-4-en-3-imine is sourced from PubChem (CID 118346045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).