C34H31N5O2 — CID 118346184
9-[4-(4-methylpiperazin-1-yl)phenyl]-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one (PubChem CID 118346184) has the molecular formula C34H31N5O2 and a molecular weight of 541.66 g/mol. Its IUPAC name is 9-[4-(4-methylpiperazin-1-yl)phenyl]-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-[4-(4-methylpiperazin-1-yl)phenyl]-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 118346184 |
| Molecular Formula | C34H31N5O2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 9-[4-(4-methylpiperazin-1-yl)phenyl]-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one |
| SMILES | C=CC(=O)N1CCc2ccc(-n3c(=O)ccc4cnc5ccc(-c6ccc(N7CCN(C)CC7)cc6)cc5c43)cc21 |
| InChI | InChI=1S/C34H31N5O2/c1-3-32(40)38-15-14-24-6-11-28(21-31(24)38)39-33(41)13-8-26-22-35-30-12-7-25(20-29(30)34(26)39)23-4-9-27(10-5-23)37-18-16-36(2)17-19-37/h3-13,20-22H,1,14-19H2,2H3 |
| InChIKey | DNXDQVLTWZNPEQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|