About 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one
1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 118346211) has the molecular formula C27H23N3O2
and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one |
| PubChem CID | 118346211 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | CC(C)=C(C)C(=O)n1ccc2ccc(-n3c(=O)ccc4cnc5ccc(C)cc5c43)cc21 |
| InChI | InChI=1S/C27H23N3O2/c1-16(2)18(4)27(32)29-12-11-19-6-8-21(14-24(19)29)30-25(31)10-7-20-15-28-23-9-5-17(3)13-22(23)26(20)30/h5-15H,1-4H3 |
| InChIKey | AJYYTHJLDINMRO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one?
The IUPAC name of 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one (CID 118346211) is 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one.
What is the SMILES notation for 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one?
The canonical SMILES for 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one is CC(C)=C(C)C(=O)n1ccc2ccc(-n3c(=O)ccc4cnc5ccc(C)cc5c43)cc21.
What is the InChIKey of 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one?
The InChIKey is AJYYTHJLDINMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23N3O2/c1-16(2)18(4)27(32)29-12-11-19-6-8-21(14-24(19)29)30-25(31)10-7-20-15-28-23-9-5-17(3)13-22(23)26(20)30/h5-15H,1-4H3.
What are the key properties of 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one?
1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one has a molecular weight of 421.50 g/mol, XLogP of 5.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,3-dimethylbut-2-enoyl)indol-6-yl]-9-methylbenzo[h][1,6]naphthyridin-2-one is sourced from PubChem (CID 118346211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).