C11H16N2 — CID 118346332
1,2,4,5,6-pentamethylpyrrolo[3,2-b]pyrrole (PubChem CID 118346332) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,2,4,5,6-pentamethylpyrrolo[3,2-b]pyrrole.
| Compound Name | 1,2,4,5,6-pentamethylpyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 118346332 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,2,4,5,6-pentamethylpyrrolo[3,2-b]pyrrole |
| SMILES | Cc1c(C)n(C)c2cc(C)n(C)c12 |
| InChI | InChI=1S/C11H16N2/c1-7-6-10-11(12(7)4)8(2)9(3)13(10)5/h6H,1-5H3 |
| InChIKey | UVVOQPQHERMXDV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |