C28H30F3N3O4 — CID 118346341
(2R,3S)-3-acetyl-6,6,6-trifluoro-N-[(12S)-13-oxo-10-phenyl-4-oxa-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-2-propylhexanamide (PubChem CID 118346341) has the molecular formula C28H30F3N3O4 and a molecular weight of 529.56 g/mol. Its IUPAC name is (2R,3S)-3-acetyl-6,6,6-trifluoro-N-[(12S)-13-oxo-10-phenyl-4-oxa-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-2-propylhexanamide.
| Compound Name | (2R,3S)-3-acetyl-6,6,6-trifluoro-N-[(12S)-13-oxo-10-phenyl-4-oxa-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-2-propylhexanamide |
|---|---|
| PubChem CID | 118346341 |
| Molecular Formula | C28H30F3N3O4 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (2R,3S)-3-acetyl-6,6,6-trifluoro-N-[(12S)-13-oxo-10-phenyl-4-oxa-1,11-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraen-12-yl]-2-propylhexanamide |
| SMILES | CCC[C@@H](C(=O)N[C@H]1N=C(c2ccccc2)c2cccc3c2N(CCO3)C1=O)[C@H](CCC(F)(F)F)C(C)=O |
| InChI | InChI=1S/C28H30F3N3O4/c1-3-8-20(19(17(2)35)13-14-28(29,30)31)26(36)33-25-27(37)34-15-16-38-22-12-7-11-21(24(22)34)23(32-25)18-9-5-4-6-10-18/h4-7,9-12,19-20,25H,3,8,13-16H2,1-2H3,(H,33,36)/t19-,20-,25-/m1/s1 |
| InChIKey | UNHGXRYSHOOKAI-UMEGOILYSA-N |
| XLogP | 4.67 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |