C19H26O3 — CID 11834664
(1R,4S,5S)-2,6,6-trimethyl-4-(2,4,6-trimethoxyphenyl)bicyclo[3.1.1]hept-2-ene (PubChem CID 11834664) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (1R,4S,5S)-2,6,6-trimethyl-4-(2,4,6-trimethoxyphenyl)bicyclo[3.1.1]hept-2-ene.
| Compound Name | (1R,4S,5S)-2,6,6-trimethyl-4-(2,4,6-trimethoxyphenyl)bicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 11834664 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1R,4S,5S)-2,6,6-trimethyl-4-(2,4,6-trimethoxyphenyl)bicyclo[3.1.1]hept-2-ene |
| SMILES | COc1cc(OC)c([C@H]2C=C(C)[C@H]3C[C@@H]2C3(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H26O3/c1-11-7-13(15-10-14(11)19(15,2)3)18-16(21-5)8-12(20-4)9-17(18)22-6/h7-9,13-15H,10H2,1-6H3/t13-,14+,15-/m0/s1 |
| InChIKey | ZMFODHOIRRPETD-ZNMIVQPWSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|